Products 879290-97-8
CAS 879290-97-8 is the registry number for Psoracorylifol A. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
4-[(S)-[(3S,6S)-3-ethenyl-3-methyl-6-prop-1-en-2-yloxan-2-yl]-hydroxymethyl]phenol (CAS 879290-97-8) is a chemical compound with the molecular formula C18H24O3 and a molecular weight of 288.4 g/mol. IUPAC name: 4-[(S)-[(3S,6S)-3-ethenyl-3-methyl-6-prop-1-en-2-yloxan-2-yl]-hydroxymethyl]phenol. InChIKey: VLFQGDGCZKMBDA-UKSPMXFCSA-N.
| Molecular formula | C18H24O3 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-[(S)-[(3S,6S)-3-ethenyl-3-methyl-6-prop-1-en-2-yloxan-2-yl]-hydroxymethyl]phenol |
| InChIKey | VLFQGDGCZKMBDA-UKSPMXFCSA-N |
| SMILES | CC(=C)[C@@H]1CC[C@@](C(O1)[C@H](C2=CC=C(C=C2)O)O)(C)C=C |
Computed by PubChem (NCBI)
Synonyms:
Psoracorylifol A