CAS 87932-07-8 appears in our catalog under these names: Iopamidol EP Impurity C, Iopamidol Impurity 3(Iopamidol EP Impurity C), 5-(Acetylamino)-N1,N3-bis(2-hydroxy-1-(hydroxymethyl)ethyl)-2,4,6-triiodo-1,3-benzenedicarboxamide(Iopamidol EP Impurity C). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-acetamido-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide (CAS 87932-07-8) is a chemical compound with the molecular formula C16H20I3N3O7 and a molecular weight of 747.06 g/mol. IUPAC name: 5-acetamido-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide. InChIKey: XCKGITXCDJXPJF-UHFFFAOYSA-N.
| Molecular formula | C16H20I3N3O7 |
|---|---|
| Molecular weight | 747.06 g/mol |
| IUPAC name | 5-acetamido-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| InChIKey | XCKGITXCDJXPJF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)NC(CO)CO)I)C(=O)NC(CO)CO)I |
Computed by PubChem (NCBI)