CAS 87942-08-3 is the registry number for 4-n-Propylphenylmagnesium bromide, 0.5M solution in THF, AcroSeal®. Offered by: Thermo Scientific (Acros). Available pack sizes: 50ML.
Magnesium;propylbenzene;bromide (CAS 87942-08-3) is a chemical compound with the molecular formula C9H11BrMg and a molecular weight of 223.39 g/mol. IUPAC name: magnesium;propylbenzene;bromide. InChIKey: URDLBLBYYUFLSI-UHFFFAOYSA-M.
| Molecular formula | C9H11BrMg |
|---|---|
| Molecular weight | 223.39 g/mol |
| IUPAC name | magnesium;propylbenzene;bromide |
| InChIKey | URDLBLBYYUFLSI-UHFFFAOYSA-M |
| SMILES | CCCC1=CC=[C-]C=C1.[Mg+2].[Br-] |
Computed by PubChem (NCBI)