Products 87943-99-5

CAS 87943-99-5 is the registry number for Ethyl 2-bromo-3-oxopentanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-bromo-3-oxopentanoate (CAS 87943-99-5) is a chemical compound with the molecular formula C7H11BrO3 and a molecular weight of 223.06 g/mol. IUPAC name: ethyl 2-bromo-3-oxopentanoate. InChIKey: LQCVYVLCWYFSKY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11BrO3
Molecular weight223.06 g/mol
IUPAC nameethyl 2-bromo-3-oxopentanoate
InChIKeyLQCVYVLCWYFSKY-UHFFFAOYSA-N
SMILESCCC(=O)C(C(=O)OCC)Br

Computed by PubChem (NCBI)