Products 879450-95-0
CAS 879450-95-0 is the registry number for Ethyl 1-(2-formyl-4-nitrophenyl)piperidine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
Ethyl 1-(2-formyl-4-nitrophenyl)piperidine-4-carboxylate (CAS 879450-95-0) is a chemical compound with the molecular formula C15H18N2O5 and a molecular weight of 306.31 g/mol. IUPAC name: ethyl 1-(2-formyl-4-nitrophenyl)piperidine-4-carboxylate. InChIKey: MBXUOLZJTSBTPJ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O5 |
|---|---|
| Molecular weight | 306.31 g/mol |
| IUPAC name | ethyl 1-(2-formyl-4-nitrophenyl)piperidine-4-carboxylate |
| InChIKey | MBXUOLZJTSBTPJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)