Products 879498-90-5
CAS 879498-90-5 is the registry number for tert-Butyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate (CAS 879498-90-5) is a chemical compound with the molecular formula C19H24BrNO2 and a molecular weight of 378.3 g/mol. IUPAC name: tert-butyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate. InChIKey: NHDARNHWERPVGS-UHFFFAOYSA-N.
| Molecular formula | C19H24BrNO2 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | tert-butyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate |
| InChIKey | NHDARNHWERPVGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(C=C1)C(=C(N2)Br)C3CCCCC3 |
Computed by PubChem (NCBI)