CAS 87961-72-6 is the registry number for (3-Nitrophenyl)(triphenylphosphine)gold, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Gold(1+);nitrobenzene;triphenylphosphanium (CAS 87961-72-6) is a chemical compound with the molecular formula C24H20AuNO2P+ and a molecular weight of 582.4 g/mol. IUPAC name: gold(1+);nitrobenzene;triphenylphosphanium. InChIKey: TXGOFJUGVDHZLN-UHFFFAOYSA-O.
| Molecular formula | C24H20AuNO2P+ |
|---|---|
| Molecular weight | 582.4 g/mol |
| IUPAC name | gold(1+);nitrobenzene;triphenylphosphanium |
| InChIKey | TXGOFJUGVDHZLN-UHFFFAOYSA-O |
| SMILES | C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.C1=C[C-]=CC(=C1)[N+](=O)[O-].[Au+] |
Computed by PubChem (NCBI)