Products 879773-55-4
CAS 879773-55-4 is the registry number for Methyl 4-((3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)methyl)benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate (CAS 879773-55-4) is a chemical compound with the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. IUPAC name: methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate. InChIKey: GNQSONRTGCRWDC-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O4 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
| InChIKey | GNQSONRTGCRWDC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(C=C2)C(=O)OC)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)