CAS 879896-63-6 is the registry number for 7-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carboxylic acid (CAS 879896-63-6) is a chemical compound with the molecular formula C7H5BrO4S and a molecular weight of 265.08 g/mol. IUPAC name: 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carboxylic acid. InChIKey: KIURUSHZGLZLSQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO4S |
|---|---|
| Molecular weight | 265.08 g/mol |
| IUPAC name | 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carboxylic acid |
| InChIKey | KIURUSHZGLZLSQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(SC(=C2O1)C(=O)O)Br |
Computed by PubChem (NCBI)