CAS 879904-88-8 appears in our catalog under these names: 2-Furyldimethylsilanol sodium salt, 95%, 2-Furyldimethylsilanol sodium salt, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Sodium furan-2-yl-dimethyl-oxidosilane (CAS 879904-88-8) is a chemical compound with the molecular formula C6H9NaO2Si and a molecular weight of 164.21 g/mol. IUPAC name: sodium furan-2-yl-dimethyl-oxidosilane. InChIKey: LZJRCLPTAZMQQW-UHFFFAOYSA-N.
| Molecular formula | C6H9NaO2Si |
|---|---|
| Molecular weight | 164.21 g/mol |
| IUPAC name | sodium furan-2-yl-dimethyl-oxidosilane |
| InChIKey | LZJRCLPTAZMQQW-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1=CC=CO1)[O-].[Na+] |
Computed by PubChem (NCBI)