CAS 87992-62-9 is the registry number for 2-Iodo-N-(4-(6-methylbenzo[d]thiazol-2-yl)phenyl)acetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide (CAS 87992-62-9) is a chemical compound with the molecular formula C16H13IN2OS and a molecular weight of 408.3 g/mol. IUPAC name: 2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide. InChIKey: PKLHKGNTARKGAK-UHFFFAOYSA-N.
| Molecular formula | C16H13IN2OS |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | 2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
| InChIKey | PKLHKGNTARKGAK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)NC(=O)CI |
Computed by PubChem (NCBI)