CAS 88-39-1 appears in our catalog under these names: Benzaldehyde-2,4-disulfonic acid, 95%, 4-Formylbenzene-1,3-disulfonic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-formylbenzene-1,3-disulfonic acid (CAS 88-39-1) is a chemical compound with the molecular formula C7H6O7S2 and a molecular weight of 266.3 g/mol. IUPAC name: 4-formylbenzene-1,3-disulfonic acid. InChIKey: PQYVGRGYAZDHFY-UHFFFAOYSA-N.
| Molecular formula | C7H6O7S2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 4-formylbenzene-1,3-disulfonic acid |
| InChIKey | PQYVGRGYAZDHFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)C=O |
Computed by PubChem (NCBI)