Products 88-61-9
CAS 88-61-9 appears in our catalog under these names: M-Xylene-4-sulfonic acid hydrate, 98%, 2,4-Dimethylbenzenesulfonic acid, 98%, Vortioxetine Impurity 85 Monohydrate, 2,4-Xylenesulfonic Acid, m–Xylene–4–sulfonic Acid Hydrate. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TCI. Available pack sizes: 5g, 500g, 25g, 100g, 1kg, on request, 1g, 2,5g.
2,4-dimethylbenzenesulfonic acid (CAS 88-61-9) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: 2,4-dimethylbenzenesulfonic acid. InChIKey: CHZLVSBMXZSPNN-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | 2,4-dimethylbenzenesulfonic acid |
| InChIKey | CHZLVSBMXZSPNN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
2,4-Xylenesulfonic acid, m-Xylene-4-sulfonic acid, m-Xylenesulfonic acid, m-Xylene-4-sulphonic acid, Benzenesulfonic acid, 2,4-dimethyl-, 4-11-00-00500 (Beilstein Handbook Reference), 2,4-dimethylbenzene-1-sulfonic acid, M-Xylene-4-sulfonic Acid Hydrate, 2,4-Dimethyl-benzenesulfonic acid, 2,4-DimethylbenzenesulfonicAcid