Products 88-90-4

CAS 88-90-4 is the registry number for 2,6-Dinitrotoluene-4-sulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-methyl-3,5-dinitrobenzenesulfonic acid (CAS 88-90-4) is a chemical compound with the molecular formula C7H6N2O7S and a molecular weight of 262.20 g/mol. IUPAC name: 4-methyl-3,5-dinitrobenzenesulfonic acid. InChIKey: SWBCSBNHMVLMKP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O7S
Molecular weight262.20 g/mol
IUPAC name4-methyl-3,5-dinitrobenzenesulfonic acid
InChIKeySWBCSBNHMVLMKP-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1[N+](=O)[O-])S(=O)(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)