CAS 88-90-4 is the registry number for 2,6-Dinitrotoluene-4-sulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-methyl-3,5-dinitrobenzenesulfonic acid (CAS 88-90-4) is a chemical compound with the molecular formula C7H6N2O7S and a molecular weight of 262.20 g/mol. IUPAC name: 4-methyl-3,5-dinitrobenzenesulfonic acid. InChIKey: SWBCSBNHMVLMKP-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O7S |
|---|---|
| Molecular weight | 262.20 g/mol |
| IUPAC name | 4-methyl-3,5-dinitrobenzenesulfonic acid |
| InChIKey | SWBCSBNHMVLMKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])S(=O)(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)