CAS 880-78-4 appears in our catalog under these names: Pentafluoronitrobenzene, 95%, Pentafluoronitrobenzene, >97.0%(GC), 1,2,3,4,5-Pentafluoro-6-nitrobenzene 98%, PENTAFLUORONITROBENZENE, 98%, 1,2,3,4,5-Pentafluoro-6-nitrobenzene, 98%, 98%. Offered by: Combi-blocks, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 1g, 25g, 100g, 100mg, 250mg, 10g, 50g.
1,2,3,4,5-pentafluoro-6-nitrobenzene (CAS 880-78-4) is a chemical compound with the molecular formula C6F5NO2 and a molecular weight of 213.06 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-nitrobenzene. InChIKey: INUOFQAJCYUOJR-UHFFFAOYSA-N.
| Molecular formula | C6F5NO2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-nitrobenzene |
| InChIKey | INUOFQAJCYUOJR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)