CAS 880000-54-4 is the registry number for (R)-1-(3-Fluorophenyl)ethane-1,2-diol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R)-1-(3-fluorophenyl)ethane-1,2-diol (CAS 880000-54-4) is a chemical compound with the molecular formula C8H9FO2 and a molecular weight of 156.15 g/mol. IUPAC name: (1R)-1-(3-fluorophenyl)ethane-1,2-diol. InChIKey: FMMQDBBTPHYEPA-QMMMGPOBSA-N.
| Molecular formula | C8H9FO2 |
|---|---|
| Molecular weight | 156.15 g/mol |
| IUPAC name | (1R)-1-(3-fluorophenyl)ethane-1,2-diol |
| InChIKey | FMMQDBBTPHYEPA-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](CO)O |
Computed by PubChem (NCBI)