Products 880100-30-1

CAS 880100-30-1 is the registry number for 1-N-Boc-3-methylbutane-1,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-amino-3-methylbutyl)carbamate (CAS 880100-30-1) is a chemical compound with the molecular formula C10H22N2O2 and a molecular weight of 202.29 g/mol. IUPAC name: tert-butyl N-(3-amino-3-methylbutyl)carbamate. InChIKey: LNUYIIBVIUELNO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22N2O2
Molecular weight202.29 g/mol
IUPAC nametert-butyl N-(3-amino-3-methylbutyl)carbamate
InChIKeyLNUYIIBVIUELNO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC(C)(C)N

Computed by PubChem (NCBI)