CAS 880139-21-9 is the registry number for (2-indol-3-ylethyl)((4-(trifluoromethoxy)phenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2-(1H-indol-3-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide (CAS 880139-21-9) is a chemical compound with the molecular formula C17H15F3N2O3S and a molecular weight of 384.4 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide. InChIKey: RDTWOTFBFJMMNH-UHFFFAOYSA-N.
| Molecular formula | C17H15F3N2O3S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide |
| InChIKey | RDTWOTFBFJMMNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNS(=O)(=O)C3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)