CAS 880266-91-1 is the registry number for Pennsylvania green, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2,7-difluoro-6-hydroxy-9-(2-methylphenyl)xanthen-3-one (CAS 880266-91-1) is a chemical compound with the molecular formula C20H12F2O3 and a molecular weight of 338.3 g/mol. IUPAC name: 2,7-difluoro-6-hydroxy-9-(2-methylphenyl)xanthen-3-one. InChIKey: OLGHTNOAGHLUQB-UHFFFAOYSA-N.
| Molecular formula | C20H12F2O3 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 2,7-difluoro-6-hydroxy-9-(2-methylphenyl)xanthen-3-one |
| InChIKey | OLGHTNOAGHLUQB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)F)O)F |
Computed by PubChem (NCBI)