CAS 88032-13-7 appears in our catalog under these names: 2,5-(2-Chlorophenyl)-phenyl-1,3,4-triazole, 95%, 2,5-(2-Chlorophenyl)-phenyl-1,3,4-triazole, 3,5-Bis(2-chlorophenyl)-4-phenyl-4H-1,2,4-triazole 97%, 3,5-Bis(2-chlorophenyl)-4-phenyl-4H-1,2,4-triazole, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 100mg.
3,5-bis(2-chlorophenyl)-4-phenyl-1,2,4-triazole (CAS 88032-13-7) is a chemical compound with the molecular formula C20H13Cl2N3 and a molecular weight of 366.2 g/mol. IUPAC name: 3,5-bis(2-chlorophenyl)-4-phenyl-1,2,4-triazole. InChIKey: UCGNEMMOWHQWTM-UHFFFAOYSA-N.
| Molecular formula | C20H13Cl2N3 |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | 3,5-bis(2-chlorophenyl)-4-phenyl-1,2,4-triazole |
| InChIKey | UCGNEMMOWHQWTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=C2C3=CC=CC=C3Cl)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)