CAS 880384-52-1 is the registry number for Imidodicarbonic acid, (2-bromo-4-fluoro-6-nitrophenyl)-, bis(1,1-dimethylethyl) ester, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(2-bromo-4-fluoro-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 880384-52-1) is a chemical compound with the molecular formula C16H20BrFN2O6 and a molecular weight of 435.24 g/mol. IUPAC name: tert-butyl N-(2-bromo-4-fluoro-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: AQZOSVGQCGBEPO-UHFFFAOYSA-N.
| Molecular formula | C16H20BrFN2O6 |
|---|---|
| Molecular weight | 435.24 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-4-fluoro-6-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | AQZOSVGQCGBEPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C=C(C=C1Br)F)[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)