CAS 880413-56-9 is the registry number for N-(2-Fluorophenyl)picolinamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-(2-fluorophenyl)pyridine-2-carboxamide (CAS 880413-56-9) is a chemical compound with the molecular formula C12H9FN2O and a molecular weight of 216.21 g/mol. IUPAC name: N-(2-fluorophenyl)pyridine-2-carboxamide. InChIKey: JUQOFSCVWHUZLH-UHFFFAOYSA-N.
| Molecular formula | C12H9FN2O |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | N-(2-fluorophenyl)pyridine-2-carboxamide |
| InChIKey | JUQOFSCVWHUZLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C2=CC=CC=N2)F |
Computed by PubChem (NCBI)