CAS 880450-05-5 is the registry number for 4-(4-Methoxyphenyl)-1,7λâ¶-dithia-4-azaspiro(4.4)nonane-3,7,7-trione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4-methoxyphenyl)-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one (CAS 880450-05-5) is a chemical compound with the molecular formula C13H15NO4S2 and a molecular weight of 313.4 g/mol. IUPAC name: 4-(4-methoxyphenyl)-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one. InChIKey: DBIDUCUZDRKEKS-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4S2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one |
| InChIKey | DBIDUCUZDRKEKS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)CSC23CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)