CAS 88064-00-0 is the registry number for Bis(1H-benzo(d)(1,2,3)triazol-1-yl)methane, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
1-(benzotriazol-1-ylmethyl)benzotriazole (CAS 88064-00-0) is a chemical compound with the molecular formula C13H10N6 and a molecular weight of 250.26 g/mol. IUPAC name: 1-(benzotriazol-1-ylmethyl)benzotriazole. InChIKey: AHJLYTGICCGNSJ-UHFFFAOYSA-N.
| Molecular formula | C13H10N6 |
|---|---|
| Molecular weight | 250.26 g/mol |
| IUPAC name | 1-(benzotriazol-1-ylmethyl)benzotriazole |
| InChIKey | AHJLYTGICCGNSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2CN3C4=CC=CC=C4N=N3 |
Computed by PubChem (NCBI)