CAS 880800-21-5 is the registry number for N4-[1,1′-Biphenyl]-4-yl-N1-1-naphthalenyl-N1-phenyl-1,4-benzenediamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-N-naphthalen-1-yl-4-N-phenyl-1-N-(4-phenylphenyl)benzene-1,4-diamine (CAS 880800-21-5) is a chemical compound with the molecular formula C34H26N2 and a molecular weight of 462.6 g/mol. IUPAC name: 4-N-naphthalen-1-yl-4-N-phenyl-1-N-(4-phenylphenyl)benzene-1,4-diamine. InChIKey: CMKGTQDXQDVHFN-UHFFFAOYSA-N.
| Molecular formula | C34H26N2 |
|---|---|
| Molecular weight | 462.6 g/mol |
| IUPAC name | 4-N-naphthalen-1-yl-4-N-phenyl-1-N-(4-phenylphenyl)benzene-1,4-diamine |
| InChIKey | CMKGTQDXQDVHFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC6=CC=CC=C65 |
Computed by PubChem (NCBI)