CAS 881-33-4 appears in our catalog under these names: Methotrexate Impurity 30, 2,4-Diamino-7-Pteridinemethanol, >95% (HPLC), 2,4-Diamino-7-pteridinemethanol. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 50mg.
(2,4-diaminopteridin-7-yl)methanol (CAS 881-33-4) is a chemical compound with the molecular formula C7H8N6O and a molecular weight of 192.18 g/mol. IUPAC name: (2,4-diaminopteridin-7-yl)methanol. InChIKey: YKUFJEGZKCTYEE-UHFFFAOYSA-N.
| Molecular formula | C7H8N6O |
|---|---|
| Molecular weight | 192.18 g/mol |
| IUPAC name | (2,4-diaminopteridin-7-yl)methanol |
| InChIKey | YKUFJEGZKCTYEE-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=N1)C(=NC(=N2)N)N)CO |
Computed by PubChem (NCBI)