CAS 881041-26-5 appears in our catalog under these names: 1-(2-Chloro-4-nitrophenyl)-1h-pyrrole-2-carbaldehyde, 95%, 1-(2-Chloro-4-nitrophenyl)-1h-pyrrole-2-carbaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 50mg, 1000mg, 500mg.
1-(2-chloro-4-nitrophenyl)pyrrole-2-carbaldehyde (CAS 881041-26-5) is a chemical compound with the molecular formula C11H7ClN2O3 and a molecular weight of 250.64 g/mol. IUPAC name: 1-(2-chloro-4-nitrophenyl)pyrrole-2-carbaldehyde. InChIKey: FYRDTQNZHORAFV-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O3 |
|---|---|
| Molecular weight | 250.64 g/mol |
| IUPAC name | 1-(2-chloro-4-nitrophenyl)pyrrole-2-carbaldehyde |
| InChIKey | FYRDTQNZHORAFV-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)