CAS 881180-23-0 is the registry number for Aldehydo-D-glucose phthalazin-1-yl hydrazone. Offered by: Biosynth. Available pack sizes: 10mg, 5mg.
(6E)-6-(phthalazin-1-ylhydrazinylidene)hexane-1,2,3,4,5-pentol (CAS 881180-23-0) is a chemical compound with the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. IUPAC name: (6E)-6-(phthalazin-1-ylhydrazinylidene)hexane-1,2,3,4,5-pentol. InChIKey: PPCQJKUJOONNDF-OMCISZLKSA-N.
| Molecular formula | C14H18N4O5 |
|---|---|
| Molecular weight | 322.32 g/mol |
| IUPAC name | (6E)-6-(phthalazin-1-ylhydrazinylidene)hexane-1,2,3,4,5-pentol |
| InChIKey | PPCQJKUJOONNDF-OMCISZLKSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN=C2N/N=C/C(C(C(C(CO)O)O)O)O |
Computed by PubChem (NCBI)