CAS 88122-99-0 appears in our catalog under these names: Octyl triazone, 97%, Ethylhexyl Triazone, Ethylhexyl Triazone/ 99.84% (existing batch purity), Ethylhexyl triazone (Octyl triazone), 2,4,6-Trianilino-p-(carbo-2'-ethylhexyl-1'-oxy)-1,3,5-triazine. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 25g, 100g, 5g, on request, 1g, 100mg, 10mM (in 1ml dmso), 0,05kg.
2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate (CAS 88122-99-0) is a chemical compound with the molecular formula C48H66N6O6 and a molecular weight of 823.1 g/mol. IUPAC name: 2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate. InChIKey: JGUMTYWKIBJSTN-UHFFFAOYSA-N.
| Molecular formula | C48H66N6O6 |
|---|---|
| Molecular weight | 823.1 g/mol |
| IUPAC name | 2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate |
| InChIKey | JGUMTYWKIBJSTN-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)NC2=NC(=NC(=N2)NC3=CC=C(C=C3)C(=O)OCC(CC)CCCC)NC4=CC=C(C=C4)C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)