CAS 881291-07-2 is the registry number for 6-(Pyrrolidine-1-sulfonyl)-1,3-benzothiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-amine (CAS 881291-07-2) is a chemical compound with the molecular formula C11H13N3O2S2 and a molecular weight of 283.4 g/mol. IUPAC name: 6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-amine. InChIKey: KCOATLSYQAGZKY-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S2 |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-amine |
| InChIKey | KCOATLSYQAGZKY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)