Products 881406-27-5

CAS 881406-27-5 is the registry number for 1-Tosyl-1H-pyrrole-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(4-methylphenyl)sulfonylpyrrole-3-sulfonyl chloride (CAS 881406-27-5) is a chemical compound with the molecular formula C11H10ClNO4S2 and a molecular weight of 319.8 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrole-3-sulfonyl chloride. InChIKey: COJANHGXGABAHS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO4S2
Molecular weight319.8 g/mol
IUPAC name1-(4-methylphenyl)sulfonylpyrrole-3-sulfonyl chloride
InChIKeyCOJANHGXGABAHS-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)