CAS 88159-25-5 appears in our catalog under these names: m–Tolyltetrazolium Red, m-Tolyltetrazolium Red, >80.0%(HPLC), M-TolyltetrazoliumRed, 80.0%, 80.0%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 100mg, 1g.
2-(3-methylphenyl)-3,5-diphenyltetrazol-3-ium chloride (CAS 88159-25-5) is a chemical compound with the molecular formula C20H17ClN4 and a molecular weight of 348.8 g/mol. IUPAC name: 2-(3-methylphenyl)-3,5-diphenyltetrazol-3-ium chloride. InChIKey: ARLMHAOZVFIBCT-UHFFFAOYSA-M.
| Molecular formula | C20H17ClN4 |
|---|---|
| Molecular weight | 348.8 g/mol |
| IUPAC name | 2-(3-methylphenyl)-3,5-diphenyltetrazol-3-ium chloride |
| InChIKey | ARLMHAOZVFIBCT-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC=C1)N2N=C(N=[N+]2C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)