Products 881656-77-5
CAS 881656-77-5 is the registry number for rac-tert-Butyl N-{((1R,3S)-3-(hydroxymethyl)cyclohexyl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
Tert-butyl N-[[(1R,3S)-3-(hydroxymethyl)cyclohexyl]methyl]carbamate (CAS 881656-77-5) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl N-[[(1R,3S)-3-(hydroxymethyl)cyclohexyl]methyl]carbamate. InChIKey: DBWREWKJBLECNR-MNOVXSKESA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl N-[[(1R,3S)-3-(hydroxymethyl)cyclohexyl]methyl]carbamate |
| InChIKey | DBWREWKJBLECNR-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCC[C@@H](C1)CO |
Computed by PubChem (NCBI)