CAS 88166-54-5 is the registry number for 6-Chloropurine, Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g, 25g.
6-chloro-7H-purine;hydrochloride (CAS 88166-54-5) is a chemical compound with the molecular formula C5H4Cl2N4 and a molecular weight of 191.02 g/mol. IUPAC name: 6-chloro-7H-purine;hydrochloride. InChIKey: UYGNXRBDDSTKED-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N4 |
|---|---|
| Molecular weight | 191.02 g/mol |
| IUPAC name | 6-chloro-7H-purine;hydrochloride |
| InChIKey | UYGNXRBDDSTKED-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)Cl.Cl |
Computed by PubChem (NCBI)