CAS 881732-90-7 appears in our catalog under these names: Vonoprazan Impurity X, N-Methyl-1-(5-phenyl-1-(pyridin-3-ylsulfonyl)-1H-pyrrol-3-yl)methanamine, 95%, 95%, TAK438 Impurity 6, TAK438 Impurity 6 Fumarate. Offered by: Chemat Brand, Chemat, Hubei YoungXin. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200mg.
N-methyl-1-(5-phenyl-1-pyridin-3-ylsulfonylpyrrol-3-yl)methanamine (CAS 881732-90-7) is a chemical compound with the molecular formula C17H17N3O2S and a molecular weight of 327.4 g/mol. IUPAC name: N-methyl-1-(5-phenyl-1-pyridin-3-ylsulfonylpyrrol-3-yl)methanamine. InChIKey: YJHAQNMEDLAMGO-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O2S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | N-methyl-1-(5-phenyl-1-pyridin-3-ylsulfonylpyrrol-3-yl)methanamine |
| InChIKey | YJHAQNMEDLAMGO-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=CC=C2)S(=O)(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)