CAS 881838-94-4 appears in our catalog under these names: 2,6–Diphenyldithieno(3,2–b:2',3'–d)thiophene, 2,6-Diphenyldithieno[3,2-b:2',3'-d]thiophene, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 500mg, 50mg, 250mg.
4,10-diphenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (CAS 881838-94-4) is a chemical compound with the molecular formula C20H12S3 and a molecular weight of 348.5 g/mol. IUPAC name: 4,10-diphenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene. InChIKey: DHVHYUGTODNKLB-UHFFFAOYSA-N.
| Molecular formula | C20H12S3 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 4,10-diphenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| InChIKey | DHVHYUGTODNKLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)C4=C(S3)C=C(S4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)