CAS 881844-56-0 is the registry number for (1R,4R,7R)-7-Bromo-2-((s)-1-phenylethyl)-2-azabicyclo[2.2.1]heptane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1R,4R,7R)-7-bromo-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane (CAS 881844-56-0) is a chemical compound with the molecular formula C14H18BrN and a molecular weight of 280.20 g/mol. IUPAC name: (1R,4R,7R)-7-bromo-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane. InChIKey: GLGPDOYNZDNHCK-IGHBBLSQSA-N.
| Molecular formula | C14H18BrN |
|---|---|
| Molecular weight | 280.20 g/mol |
| IUPAC name | (1R,4R,7R)-7-bromo-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane |
| InChIKey | GLGPDOYNZDNHCK-IGHBBLSQSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2C[C@H]3CC[C@@H]2[C@@H]3Br |
Computed by PubChem (NCBI)