CAS 881912-14-7 appears in our catalog under these names: 2–(3–Bromophenyl)–9,9–dimethyl–9H–fuorene, 2-(3-Bromophenyl)-9,9-dimethyl-9H-fluorene, >98.0%(GC), 2-(3-Bromophenyl)-9,9-dimethyl-9H-fluorene. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
2-(3-bromophenyl)-9,9-dimethylfluorene (CAS 881912-14-7) is a chemical compound with the molecular formula C21H17Br and a molecular weight of 349.3 g/mol. IUPAC name: 2-(3-bromophenyl)-9,9-dimethylfluorene. InChIKey: DOCPABXUROJRDW-UHFFFAOYSA-N.
| Molecular formula | C21H17Br |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 2-(3-bromophenyl)-9,9-dimethylfluorene |
| InChIKey | DOCPABXUROJRDW-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4=CC(=CC=C4)Br)C |
Computed by PubChem (NCBI)