Products 881913-43-5

CAS 881913-43-5 is the registry number for Fmoc-Gly-Sulfamoylbenzoic Acid. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]sulfamoyl]benzoic acid (CAS 881913-43-5) is a chemical compound with the molecular formula C24H20N2O7S and a molecular weight of 480.5 g/mol. IUPAC name: 4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]sulfamoyl]benzoic acid. InChIKey: MSPGQZFVLOGOCA-UHFFFAOYSA-N.

Identity
Molecular formulaC24H20N2O7S
Molecular weight480.5 g/mol
IUPAC name4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]sulfamoyl]benzoic acid
InChIKeyMSPGQZFVLOGOCA-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)NS(=O)(=O)C4=CC=C(C=C4)C(=O)O

Computed by PubChem (NCBI)