CAS 882-67-7 appears in our catalog under these names: 3-(2-Hydroxyethyl)-1,3-diazaspiro(4.5)decane-2,4-dione, 95%, 3-(2-Hydroxyethyl)-1,3-diazaspiro(4.5)decane-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(2-hydroxyethyl)-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 882-67-7) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: 3-(2-hydroxyethyl)-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: MACNLYNLRKUQOA-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 3-(2-hydroxyethyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | MACNLYNLRKUQOA-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)N(C(=O)N2)CCO |
Computed by PubChem (NCBI)