CAS 882231-97-2 is the registry number for 1-(4-(4-Ethylbenzenesulfonyl)phenyl)-3-methyl-1H-pyrazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 10g.
2-[4-(4-ethylphenyl)sulfonylphenyl]-5-methylpyrazol-3-amine (CAS 882231-97-2) is a chemical compound with the molecular formula C18H19N3O2S and a molecular weight of 341.4 g/mol. IUPAC name: 2-[4-(4-ethylphenyl)sulfonylphenyl]-5-methylpyrazol-3-amine. InChIKey: HDBBQYILLQZSFM-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O2S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[4-(4-ethylphenyl)sulfonylphenyl]-5-methylpyrazol-3-amine |
| InChIKey | HDBBQYILLQZSFM-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N3C(=CC(=N3)C)N |
Computed by PubChem (NCBI)