CAS 882283-23-0 is the registry number for N-(2-Amino-2-oxoethyl)-2-(benzo[d]thiazol-2-ylthio)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]acetamide (CAS 882283-23-0) is a chemical compound with the molecular formula C11H11N3O2S2 and a molecular weight of 281.4 g/mol. IUPAC name: 2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]acetamide. InChIKey: CUSOKYUZJPDKIX-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S2 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 2-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]acetamide |
| InChIKey | CUSOKYUZJPDKIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCC(=O)NCC(=O)N |
Computed by PubChem (NCBI)