Products 882403-69-2
CAS 882403-69-2 is the registry number for Malonganenone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-7-[(2E,6E,11Z)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,11-trienyl]purin-6-one (CAS 882403-69-2) is a chemical compound with the molecular formula C26H38N4O2 and a molecular weight of 438.6 g/mol. IUPAC name: 3-methyl-7-[(2E,6E,11Z)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,11-trienyl]purin-6-one. InChIKey: YFUQCEYIDJYEII-HLMZKVHVSA-N.
| Molecular formula | C26H38N4O2 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | 3-methyl-7-[(2E,6E,11Z)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,11-trienyl]purin-6-one |
| InChIKey | YFUQCEYIDJYEII-HLMZKVHVSA-N |
| SMILES | CC(C)CC(=O)/C=C(/C)\CCC/C(=C/CC/C(=C/CN1C=NC2=C1C(=O)N=CN2C)/C)/C |
Computed by PubChem (NCBI)
Synonyms:
Malonganenone A, orb1703120