CAS 882518-89-0 appears in our catalog under these names: Tos-peg3-ch2co2tbu, 95%, Tos–PEG2–CH2–Boc, Tos-PEG2-CH2-Boc 97%, tert-Butyl 2-(2-(2-(tosyloxy)ethoxy)ethoxy)acetate, 98%, 98%, Tos-PEG2-CH2-Boc, 97.32%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g, 100 mg, 25 mg.
Tert-butyl 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetate (CAS 882518-89-0) is a chemical compound with the molecular formula C17H26O7S and a molecular weight of 374.5 g/mol. IUPAC name: tert-butyl 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetate. InChIKey: NIPMXQFRYHXBAM-UHFFFAOYSA-N.
| Molecular formula | C17H26O7S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetate |
| InChIKey | NIPMXQFRYHXBAM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)