CAS 882531-87-5 appears in our catalog under these names: R1530, 98%, R1530, R1530/ 97.96% (existing batch purity), 5-(2-Chlorophenyl)-7-fluoro-1,2-dihydro-8-methoxy-3-methylpyrazolo(3,4-b)(1,4)benzodiazepine, R1530, 99.06%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 1mg, 2mg, 5mg, 100mg, 50 mg.
5-(2-chlorophenyl)-7-fluoro-8-methoxy-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine (CAS 882531-87-5) is a chemical compound with the molecular formula C18H14ClFN4O and a molecular weight of 356.8 g/mol. IUPAC name: 5-(2-chlorophenyl)-7-fluoro-8-methoxy-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine. InChIKey: UOVCGJXDGOGOCZ-UHFFFAOYSA-N.
| Molecular formula | C18H14ClFN4O |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-7-fluoro-8-methoxy-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepine |
| InChIKey | UOVCGJXDGOGOCZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1)NC3=CC(=C(C=C3C(=N2)C4=CC=CC=C4Cl)F)OC |
Computed by PubChem (NCBI)