CAS 88254-99-3 appears in our catalog under these names: Netobimin Sodium Salt, >95% (HPLC), Netobimin sodium salt, Netobimin sodium salt, Concentration: 10 µg/ml Solvent: Methanol. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 100mg, 10mg, 2mg, 5mg, 25mg, 50mg, 1x5ml.
Sodium 2-[[(methoxycarbonylamino)-(2-nitro-5-propylsulfanylanilino)methylidene]amino]ethanesulfonate (CAS 88254-99-3) is a chemical compound with the molecular formula C14H19N4NaO7S2 and a molecular weight of 442.4 g/mol. IUPAC name: sodium 2-[[(methoxycarbonylamino)-(2-nitro-5-propylsulfanylanilino)methylidene]amino]ethanesulfonate. InChIKey: BYWGGBOKTFRZDR-UHFFFAOYSA-M.
| Molecular formula | C14H19N4NaO7S2 |
|---|---|
| Molecular weight | 442.4 g/mol |
| IUPAC name | sodium 2-[[(methoxycarbonylamino)-(2-nitro-5-propylsulfanylanilino)methylidene]amino]ethanesulfonate |
| InChIKey | BYWGGBOKTFRZDR-UHFFFAOYSA-M |
| SMILES | CCCSC1=CC(=C(C=C1)[N+](=O)[O-])NC(=NCCS(=O)(=O)[O-])NC(=O)OC.[Na+] |
Computed by PubChem (NCBI)