Products 88255-01-0
CAS 88255-01-0 is the registry number for Netobimin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[(methoxycarbonylamino)-(2-nitro-5-propylsulfanylanilino)methylidene]amino]ethanesulfonic acid (CAS 88255-01-0) is a chemical compound with the molecular formula C14H20N4O7S2 and a molecular weight of 420.5 g/mol. IUPAC name: 2-[[(methoxycarbonylamino)-(2-nitro-5-propylsulfanylanilino)methylidene]amino]ethanesulfonic acid. InChIKey: WCBVUETZRWGIJQ-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O7S2 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 2-[[(methoxycarbonylamino)-(2-nitro-5-propylsulfanylanilino)methylidene]amino]ethanesulfonic acid |
| InChIKey | WCBVUETZRWGIJQ-UHFFFAOYSA-N |
| SMILES | CCCSC1=CC(=C(C=C1)[N+](=O)[O-])NC(=NCCS(=O)(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)