CAS 882739-48-2 is the registry number for S-Methyl n-(2,2,2-trichloroethoxysulfonyl)carbonchloroimidothioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,2-trichloroethyl (NZ)-N-[chloro(methylsulfanyl)methylidene]sulfamate (CAS 882739-48-2) is a chemical compound with the molecular formula C4H5Cl4NO3S2 and a molecular weight of 321.0 g/mol. IUPAC name: 2,2,2-trichloroethyl (NZ)-N-[chloro(methylsulfanyl)methylidene]sulfamate. InChIKey: NGCLYHLLOXVGSU-YCRREMRBSA-N.
| Molecular formula | C4H5Cl4NO3S2 |
|---|---|
| Molecular weight | 321.0 g/mol |
| IUPAC name | 2,2,2-trichloroethyl (NZ)-N-[chloro(methylsulfanyl)methylidene]sulfamate |
| InChIKey | NGCLYHLLOXVGSU-YCRREMRBSA-N |
| SMILES | CS/C(=N/S(=O)(=O)OCC(Cl)(Cl)Cl)/Cl |
Computed by PubChem (NCBI)