CAS 882768-36-7 is the registry number for 6-Chloro-N4-(4-chlorobenzyl)pyrimidine-4,5-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine (CAS 882768-36-7) is a chemical compound with the molecular formula C11H10Cl2N4 and a molecular weight of 269.13 g/mol. IUPAC name: 6-chloro-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine. InChIKey: FOZBTSBUDBIJTO-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N4 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 6-chloro-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine |
| InChIKey | FOZBTSBUDBIJTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=C(C(=NC=N2)Cl)N)Cl |
Computed by PubChem (NCBI)