CAS 88292-57-3 is the registry number for 2,6-Diethyl-4-phenyl-1-propylpyridinium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg.
2,6-diethyl-4-phenyl-1-propylpyridin-1-ium tetrafluoroborate (CAS 88292-57-3) is a chemical compound with the molecular formula C18H24BF4N and a molecular weight of 341.2 g/mol. IUPAC name: 2,6-diethyl-4-phenyl-1-propylpyridin-1-ium tetrafluoroborate. InChIKey: LQXQUBVZUFSXDJ-UHFFFAOYSA-N.
| Molecular formula | C18H24BF4N |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | 2,6-diethyl-4-phenyl-1-propylpyridin-1-ium tetrafluoroborate |
| InChIKey | LQXQUBVZUFSXDJ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCC[N+]1=C(C=C(C=C1CC)C2=CC=CC=C2)CC |
Computed by PubChem (NCBI)