Products 88292-57-3

CAS 88292-57-3 is the registry number for 2,6-Diethyl-4-phenyl-1-propylpyridinium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

2,6-diethyl-4-phenyl-1-propylpyridin-1-ium tetrafluoroborate (CAS 88292-57-3) is a chemical compound with the molecular formula C18H24BF4N and a molecular weight of 341.2 g/mol. IUPAC name: 2,6-diethyl-4-phenyl-1-propylpyridin-1-ium tetrafluoroborate. InChIKey: LQXQUBVZUFSXDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24BF4N
Molecular weight341.2 g/mol
IUPAC name2,6-diethyl-4-phenyl-1-propylpyridin-1-ium tetrafluoroborate
InChIKeyLQXQUBVZUFSXDJ-UHFFFAOYSA-N
SMILES[B-](F)(F)(F)F.CCC[N+]1=C(C=C(C=C1CC)C2=CC=CC=C2)CC

Computed by PubChem (NCBI)